C31H43N2O4S- — CID 20648744
2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 20648744) has the molecular formula C31H43N2O4S- and a molecular weight of 539.76 g/mol. Its IUPAC name is 2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | 2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 20648744 |
| Molecular Formula | C31H43N2O4S- |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCN(CC1CCCCC1)OCc1ccc(C(=O)NC(CCSC)C(=O)[O-])c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C31H44N2O4S/c1-4-5-18-33(21-24-12-7-6-8-13-24)37-22-25-15-16-27(28(20-25)26-14-10-9-11-23(26)2)30(34)32-29(31(35)36)17-19-38-3/h9-11,14-16,20,24,29H,4-8,12-13,17-19,21-22H2,1-3H3,(H,32,34)(H,35,36)/p-1 |
| InChIKey | GWZJXRGJFACXSW-UHFFFAOYSA-M |
| XLogP | 5.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|