C31H44N2O4S — CID 20648745
2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 20648745) has the molecular formula C31H44N2O4S and a molecular weight of 540.77 g/mol. Its IUPAC name is 2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20648745 |
| Molecular Formula | C31H44N2O4S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 2-[[4-[[butyl(cyclohexylmethyl)amino]oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCCN(CC1CCCCC1)OCc1ccc(C(=O)NC(CCSC)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C31H44N2O4S/c1-4-5-18-33(21-24-12-7-6-8-13-24)37-22-25-15-16-27(28(20-25)26-14-10-9-11-23(26)2)30(34)32-29(31(35)36)17-19-38-3/h9-11,14-16,20,24,29H,4-8,12-13,17-19,21-22H2,1-3H3,(H,32,34)(H,35,36) |
| InChIKey | GWZJXRGJFACXSW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|