C33H47NO5S — CID 70225610
(2S)-2-[[4-[(1-butoxy-1-cyclohexylpropan-2-yl)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 70225610) has the molecular formula C33H47NO5S and a molecular weight of 569.81 g/mol. Its IUPAC name is (2S)-2-[[4-[(1-butoxy-1-cyclohexylpropan-2-yl)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[(1-butoxy-1-cyclohexylpropan-2-yl)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 70225610 |
| Molecular Formula | C33H47NO5S |
| Molecular Weight | 569.81 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | (2S)-2-[[4-[(1-butoxy-1-cyclohexylpropan-2-yl)oxymethyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCCOC(C1CCCCC1)C(C)OCc1ccc(C(=O)N[C@@H](CCSC)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C33H47NO5S/c1-5-6-19-38-31(26-13-8-7-9-14-26)24(3)39-22-25-16-17-28(29(21-25)27-15-11-10-12-23(27)2)32(35)34-30(33(36)37)18-20-40-4/h10-12,15-17,21,24,26,30-31H,5-9,13-14,18-20,22H2,1-4H3,(H,34,35)(H,36,37)/t24?,30-,31?/m0/s1 |
| InChIKey | FROBYQUFSCMPDU-PDKBHGNOSA-N |
| XLogP | 7.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.81 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|