C33H41N3O4S — CID 70226433
2-[[4-[3-cyclohexylpropoxy(pyridazin-4-yl)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 70226433) has the molecular formula C33H41N3O4S and a molecular weight of 575.78 g/mol. Its IUPAC name is 2-[[4-[3-cyclohexylpropoxy(pyridazin-4-yl)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-[3-cyclohexylpropoxy(pyridazin-4-yl)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 70226433 |
| Molecular Formula | C33H41N3O4S |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 2-[[4-[3-cyclohexylpropoxy(pyridazin-4-yl)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(C(OCCCC2CCCCC2)c2ccnnc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C33H41N3O4S/c1-23-9-6-7-13-27(23)29-21-25(14-15-28(29)32(37)36-30(33(38)39)17-20-41-2)31(26-16-18-34-35-22-26)40-19-8-12-24-10-4-3-5-11-24/h6-7,9,13-16,18,21-22,24,30-31H,3-5,8,10-12,17,19-20H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | CSFLAOPOMIBSOD-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|