C33H47NO4S2 — CID 67633648
2-[[4-[butylsulfanyl(1-cyclohexylpropan-2-yloxy)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 67633648) has the molecular formula C33H47NO4S2 and a molecular weight of 585.88 g/mol. Its IUPAC name is 2-[[4-[butylsulfanyl(1-cyclohexylpropan-2-yloxy)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-[butylsulfanyl(1-cyclohexylpropan-2-yloxy)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 67633648 |
| Molecular Formula | C33H47NO4S2 |
| Molecular Weight | 585.88 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 2-[[4-[butylsulfanyl(1-cyclohexylpropan-2-yloxy)methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCCSC(OC(C)CC1CCCCC1)c1ccc(C(=O)NC(CCSC)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C33H47NO4S2/c1-5-6-19-40-33(38-24(3)21-25-13-8-7-9-14-25)26-16-17-28(29(22-26)27-15-11-10-12-23(27)2)31(35)34-30(32(36)37)18-20-39-4/h10-12,15-17,22,24-25,30,33H,5-9,13-14,18-21H2,1-4H3,(H,34,35)(H,36,37) |
| InChIKey | FFZJYWVOZCTSLO-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.88 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|