C35H44N2O5S — CID 18361001
2-[[4-ethyl-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;phenyl N-(cyclohexylmethyl)carbamate (PubChem CID 18361001) has the molecular formula C35H44N2O5S and a molecular weight of 604.81 g/mol. Its IUPAC name is 2-[[4-ethyl-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;phenyl N-(cyclohexylmethyl)carbamate.
| Compound Name | 2-[[4-ethyl-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;phenyl N-(cyclohexylmethyl)carbamate |
|---|---|
| PubChem CID | 18361001 |
| Molecular Formula | C35H44N2O5S |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 2-[[4-ethyl-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid;phenyl N-(cyclohexylmethyl)carbamate |
| SMILES | CCc1ccc(C(=O)NC(CCSC)C(=O)O)c(-c2ccccc2C)c1.O=C(NCC1CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C21H25NO3S.C14H19NO2/c1-4-15-9-10-17(18(13-15)16-8-6-5-7-14(16)2)20(23)22-19(21(24)25)11-12-26-3;16-14(17-13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h5-10,13,19H,4,11-12H2,1-3H3,(H,22,23)(H,24,25);2,5-6,9-10,12H,1,3-4,7-8,11H2,(H,15,16) |
| InChIKey | NPIQXAKLEOBATP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |