C31H29LiNO3S+ — CID 22001455
lithium 2-[[2-(2-methylphenyl)-4-[(E)-2-naphthalen-1-ylethenyl]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22001455) has the molecular formula C31H29LiNO3S+ and a molecular weight of 502.59 g/mol. Its IUPAC name is lithium 2-[[2-(2-methylphenyl)-4-[(E)-2-naphthalen-1-ylethenyl]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | lithium 2-[[2-(2-methylphenyl)-4-[(E)-2-naphthalen-1-ylethenyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22001455 |
| Molecular Formula | C31H29LiNO3S+ |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | lithium 2-[[2-(2-methylphenyl)-4-[(E)-2-naphthalen-1-ylethenyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(/C=C/c2cccc3ccccc23)cc1-c1ccccc1C)C(=O)O.[Li+] |
| InChI | InChI=1S/C31H29NO3S.Li/c1-21-8-3-5-12-25(21)28-20-22(14-16-24-11-7-10-23-9-4-6-13-26(23)24)15-17-27(28)30(33)32-29(31(34)35)18-19-36-2;/h3-17,20,29H,18-19H2,1-2H3,(H,32,33)(H,34,35);/q;+1/b16-14+; |
| InChIKey | WUZGUGPRJWWMLK-BACBYAOASA-N |
| XLogP | 3.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|