C25H25LiN3O3S — CID 70226086
CID 70226086 (PubChem CID 70226086) has the molecular formula C25H25LiN3O3S and a molecular weight of 454.50 g/mol.
| Compound Name | CID 70226086 |
|---|---|
| PubChem CID | 70226086 |
| Molecular Formula | C25H25LiN3O3S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | — |
| SMILES | CSCC[C@H](NC(=O)c1ccc(C=Cc2cnccn2)cc1-c1ccccc1C)C(=O)O.[Li] |
| InChI | InChI=1S/C25H25N3O3S.Li/c1-17-5-3-4-6-20(17)22-15-18(7-9-19-16-26-12-13-27-19)8-10-21(22)24(29)28-23(25(30)31)11-14-32-2;/h3-10,12-13,15-16,23H,11,14H2,1-2H3,(H,28,29)(H,30,31);/t23-;/m0./s1 |
| InChIKey | ICSJTAGFYVYAQO-BQAIUKQQSA-N |
| XLogP | 4.18 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |