C34H33NO4S — CID 59953495
(2S)-2-[[4-[(E)-2-[4-(3-methylphenoxy)phenyl]ethenyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 59953495) has the molecular formula C34H33NO4S and a molecular weight of 551.71 g/mol. Its IUPAC name is (2S)-2-[[4-[(E)-2-[4-(3-methylphenoxy)phenyl]ethenyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[(E)-2-[4-(3-methylphenoxy)phenyl]ethenyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 59953495 |
| Molecular Formula | C34H33NO4S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | (2S)-2-[[4-[(E)-2-[4-(3-methylphenoxy)phenyl]ethenyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(/C=C/c2ccc(Oc3cccc(C)c3)cc2)cc1-c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C34H33NO4S/c1-23-7-6-9-28(21-23)39-27-16-13-25(14-17-27)11-12-26-15-18-30(31(22-26)29-10-5-4-8-24(29)2)33(36)35-32(34(37)38)19-20-40-3/h4-18,21-22,32H,19-20H2,1-3H3,(H,35,36)(H,37,38)/b12-11+/t32-/m0/s1 |
| InChIKey | SEXVXDUSKBNIFF-KOOPJGDISA-N |
| XLogP | 7.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|