C12H14Cl2N2O3S — CID 104909263
(2R)-2-[(4-amino-3,5-dichlorobenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 104909263) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is (2R)-2-[(4-amino-3,5-dichlorobenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(4-amino-3,5-dichlorobenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104909263 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (2R)-2-[(4-amino-3,5-dichlorobenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-20-3-2-9(12(18)19)16-11(17)6-4-7(13)10(15)8(14)5-6/h4-5,9H,2-3,15H2,1H3,(H,16,17)(H,18,19)/t9-/m1/s1 |
| InChIKey | BCTMLZXICWABIU-SECBINFHSA-N |
| XLogP | 2.51 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|