C14H19ClN2O5S2 — CID 41255711
(2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 41255711) has the molecular formula C14H19ClN2O5S2 and a molecular weight of 394.90 g/mol. Its IUPAC name is (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 41255711 |
| Molecular Formula | C14H19ClN2O5S2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2R)-2-[[4-chloro-3-(dimethylsulfamoyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)C)c1)C(=O)O |
| InChI | InChI=1S/C14H19ClN2O5S2/c1-17(2)24(21,22)12-8-9(4-5-10(12)15)13(18)16-11(14(19)20)6-7-23-3/h4-5,8,11H,6-7H2,1-3H3,(H,16,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | XEGPEVFNSCOBGF-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |