C18H26N2O5S2 — CID 9326285
(2R)-2-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 9326285) has the molecular formula C18H26N2O5S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (2R)-2-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 9326285 |
| Molecular Formula | C18H26N2O5S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (2R)-2-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1)C(=O)O |
| InChI | InChI=1S/C18H26N2O5S2/c1-13-6-7-14(17(21)19-15(18(22)23)8-11-26-2)12-16(13)27(24,25)20-9-4-3-5-10-20/h6-7,12,15H,3-5,8-11H2,1-2H3,(H,19,21)(H,22,23)/t15-/m1/s1 |
| InChIKey | RJUUBEKMDWFHLH-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |