C21H35N3O3S — CID 8919230
N-[2-[di(propan-2-yl)amino]ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 8919230) has the molecular formula C21H35N3O3S and a molecular weight of 409.60 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 8919230 |
| Molecular Formula | C21H35N3O3S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCN(C(C)C)C(C)C)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H35N3O3S/c1-16(2)24(17(3)4)14-11-22-21(25)19-10-9-18(5)20(15-19)28(26,27)23-12-7-6-8-13-23/h9-10,15-17H,6-8,11-14H2,1-5H3,(H,22,25) |
| InChIKey | FVTUUDYGAKJKPB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |