C21H34N2O6S — CID 99797773
N-[2-(2,2-diethoxyethoxy)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 99797773) has the molecular formula C21H34N2O6S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[2-(2,2-diethoxyethoxy)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(2,2-diethoxyethoxy)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 99797773 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[2-(2,2-diethoxyethoxy)ethyl]-4-methyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCOC(COCCNC(=O)c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1)OCC |
| InChI | InChI=1S/C21H34N2O6S/c1-4-28-20(29-5-2)16-27-14-11-22-21(24)18-10-9-17(3)19(15-18)30(25,26)23-12-7-6-8-13-23/h9-10,15,20H,4-8,11-14,16H2,1-3H3,(H,22,24) |
| InChIKey | CSSTVVPITBHQBK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|