C10H14ClN3O3S — CID 126440936
(2S)-2-[(4-chloro-5-methyl-1H-pyrazole-3-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 126440936) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-5-methyl-1H-pyrazole-3-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(4-chloro-5-methyl-1H-pyrazole-3-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 126440936 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (2S)-2-[(4-chloro-5-methyl-1H-pyrazole-3-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1n[nH]c(C)c1Cl)C(=O)O |
| InChI | InChI=1S/C10H14ClN3O3S/c1-5-7(11)8(14-13-5)9(15)12-6(10(16)17)3-4-18-2/h6H,3-4H2,1-2H3,(H,12,15)(H,13,14)(H,16,17)/t6-/m0/s1 |
| InChIKey | RZQGWABVAWWGDP-LURJTMIESA-N |
| XLogP | 1.31 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |