C9H9Cl2N3O2 — CID 32898227
3,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 32898227) has the molecular formula C9H9Cl2N3O2 and a molecular weight of 262.10 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 32898227 |
| Molecular Formula | C9H9Cl2N3O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 3,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O2/c1-12-7(15)4-13-9(16)8-5(10)2-3-6(11)14-8/h2-3H,4H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | GFCGDLGQVALOSL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|