C11H10Cl2N4O — CID 63236046
3,6-dichloro-N-[(1-methylimidazol-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 63236046) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 3,6-dichloro-N-[(1-methylimidazol-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(1-methylimidazol-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63236046 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3,6-dichloro-N-[(1-methylimidazol-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | Cn1ccnc1CNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H10Cl2N4O/c1-17-5-4-14-9(17)6-15-11(18)10-7(12)2-3-8(13)16-10/h2-5H,6H2,1H3,(H,15,18) |
| InChIKey | XKTLXCXLZXAWET-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|