C13H13ClN4O3 — CID 63294627
2-chloro-5-[(1-methylimidazol-2-yl)methylcarbamoylamino]benzoic acid (PubChem CID 63294627) has the molecular formula C13H13ClN4O3 and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-chloro-5-[(1-methylimidazol-2-yl)methylcarbamoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(1-methylimidazol-2-yl)methylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63294627 |
| Molecular Formula | C13H13ClN4O3 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-chloro-5-[(1-methylimidazol-2-yl)methylcarbamoylamino]benzoic acid |
| SMILES | Cn1ccnc1CNC(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H13ClN4O3/c1-18-5-4-15-11(18)7-16-13(21)17-8-2-3-10(14)9(6-8)12(19)20/h2-6H,7H2,1H3,(H,19,20)(H2,16,17,21) |
| InChIKey | MRIQQULZGLKXQB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |