C14H14ClN3O3S — CID 23830355
2-chloro-5-[2-(1-methylimidazol-2-yl)sulfanylpropanoylamino]benzoic acid (PubChem CID 23830355) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-chloro-5-[2-(1-methylimidazol-2-yl)sulfanylpropanoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[2-(1-methylimidazol-2-yl)sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 23830355 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-chloro-5-[2-(1-methylimidazol-2-yl)sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(Sc1nccn1C)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H14ClN3O3S/c1-8(22-14-16-5-6-18(14)2)12(19)17-9-3-4-11(15)10(7-9)13(20)21/h3-8H,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | FOKFTDDBBYPVPS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |