C12H10ClN3O4 — CID 81178009
2-chloro-5-(1,2-oxazol-3-ylmethylcarbamoylamino)benzoic acid (PubChem CID 81178009) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 2-chloro-5-(1,2-oxazol-3-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 2-chloro-5-(1,2-oxazol-3-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 81178009 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-chloro-5-(1,2-oxazol-3-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ccon1)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H10ClN3O4/c13-10-2-1-7(5-9(10)11(17)18)15-12(19)14-6-8-3-4-20-16-8/h1-5H,6H2,(H,17,18)(H2,14,15,19) |
| InChIKey | KYDXDWYFKPABOS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |