C9H9Cl2N3O2 — CID 38004196
2,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 38004196) has the molecular formula C9H9Cl2N3O2 and a molecular weight of 262.10 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 38004196 |
| Molecular Formula | C9H9Cl2N3O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2,6-dichloro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2N3O2/c1-12-8(15)4-13-9(16)5-2-6(10)14-7(11)3-5/h2-3H,4H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | HIMLCHYAFWMQBP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|