C9H11N3O2 — CID 58188881
N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 58188881) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58188881 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1ccncc1 |
| InChI | InChI=1S/C9H11N3O2/c1-10-8(13)6-12-9(14)7-2-4-11-5-3-7/h2-5H,6H2,1H3,(H,10,13)(H,12,14) |
| InChIKey | DSMQVBWCWSCKCG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |