C9H10FN3O2 — CID 61293980
2-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 61293980) has the molecular formula C9H10FN3O2 and a molecular weight of 211.20 g/mol. Its IUPAC name is 2-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61293980 |
| Molecular Formula | C9H10FN3O2 |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C9H10FN3O2/c1-11-8(14)5-13-9(15)6-2-3-12-7(10)4-6/h2-4H,5H2,1H3,(H,11,14)(H,13,15) |
| InChIKey | VKCZXKTYLLLCNI-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|