C10H13FN2O2 — CID 65106911
2-fluoro-N-(2-hydroxy-2-methylpropyl)pyridine-4-carboxamide (PubChem CID 65106911) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxy-2-methylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-(2-hydroxy-2-methylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 65106911 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-fluoro-N-(2-hydroxy-2-methylpropyl)pyridine-4-carboxamide |
| SMILES | CC(C)(O)CNC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C10H13FN2O2/c1-10(2,15)6-13-9(14)7-3-4-12-8(11)5-7/h3-5,15H,6H2,1-2H3,(H,13,14) |
| InChIKey | MOLJWGHACDOULK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|