C15H17FN2O3 — CID 111479066
N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-fluoropyridine-4-carboxamide (PubChem CID 111479066) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 111479066 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-2-fluoropyridine-4-carboxamide |
| SMILES | Cc1cc(C(C)(O)CNC(=O)c2ccnc(F)c2)c(C)o1 |
| InChI | InChI=1S/C15H17FN2O3/c1-9-6-12(10(2)21-9)15(3,20)8-18-14(19)11-4-5-17-13(16)7-11/h4-7,20H,8H2,1-3H3,(H,18,19) |
| InChIKey | WNNAJECDIHRGIB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|