C15H23FN4O — CID 61294593
2-fluoro-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pyridine-4-carboxamide (PubChem CID 61294593) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-fluoro-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61294593 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-fluoro-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]pyridine-4-carboxamide |
| SMILES | CN1CCN(C(C)(C)CNC(=O)c2ccnc(F)c2)CC1 |
| InChI | InChI=1S/C15H23FN4O/c1-15(2,20-8-6-19(3)7-9-20)11-18-14(21)12-4-5-17-13(16)10-12/h4-5,10H,6-9,11H2,1-3H3,(H,18,21) |
| InChIKey | ZLSAPUMHCOWOMU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|