C13H9Cl2N3O — CID 78852900
4,5-dichloro-N-[(4-cyanophenyl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 78852900) has the molecular formula C13H9Cl2N3O and a molecular weight of 294.14 g/mol. Its IUPAC name is 4,5-dichloro-N-[(4-cyanophenyl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-[(4-cyanophenyl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78852900 |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 4,5-dichloro-N-[(4-cyanophenyl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cc(Cl)c(Cl)[nH]2)cc1 |
| InChI | InChI=1S/C13H9Cl2N3O/c14-10-5-11(18-12(10)15)13(19)17-7-9-3-1-8(6-16)2-4-9/h1-5,18H,7H2,(H,17,19) |
| InChIKey | VMNPURDRBGHFGF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |