C19H16ClNO3 — CID 8797487
2-(4-chloro-3-methylphenoxy)-N-(2-hydroxynaphthalen-1-yl)acetamide (PubChem CID 8797487) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(2-hydroxynaphthalen-1-yl)acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(2-hydroxynaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 8797487 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(2-hydroxynaphthalen-1-yl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2c(O)ccc3ccccc23)ccc1Cl |
| InChI | InChI=1S/C19H16ClNO3/c1-12-10-14(7-8-16(12)20)24-11-18(23)21-19-15-5-3-2-4-13(15)6-9-17(19)22/h2-10,22H,11H2,1H3,(H,21,23) |
| InChIKey | RAHIVGLKSJLTFZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|