C20H17Cl2NO — CID 7899735
2-(2,6-dichlorophenyl)-N-[(1R)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 7899735) has the molecular formula C20H17Cl2NO and a molecular weight of 358.27 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-[(1R)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-[(1R)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 7899735 |
| Molecular Formula | C20H17Cl2NO |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-[(1R)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1c(Cl)cccc1Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17Cl2NO/c1-13(15-10-9-14-5-2-3-6-16(14)11-15)23-20(24)12-17-18(21)7-4-8-19(17)22/h2-11,13H,12H2,1H3,(H,23,24)/t13-/m1/s1 |
| InChIKey | WLWQPEXKYGYYHF-CYBMUJFWSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |