C15H34NO6P — CID 175492996
N-(2-hydroxypropyl)dodecanamide;phosphoric acid (PubChem CID 175492996) has the molecular formula C15H34NO6P and a molecular weight of 355.41 g/mol. Its IUPAC name is N-(2-hydroxypropyl)dodecanamide;phosphoric acid.
| Compound Name | N-(2-hydroxypropyl)dodecanamide;phosphoric acid |
|---|---|
| PubChem CID | 175492996 |
| Molecular Formula | C15H34NO6P |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-(2-hydroxypropyl)dodecanamide;phosphoric acid |
| SMILES | CCCCCCCCCCCC(=O)NCC(C)O.O=P(O)(O)O |
| InChI | InChI=1S/C15H31NO2.H3O4P/c1-3-4-5-6-7-8-9-10-11-12-15(18)16-13-14(2)17;1-5(2,3)4/h14,17H,3-13H2,1-2H3,(H,16,18);(H3,1,2,3,4) |
| InChIKey | PJAMPTDIXSSKRL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|