C23H46N2O2 — CID 118235409
(Z)-N-[(3R)-3-amino-4-hydroxy-2-methylbutyl]octadec-9-enamide (PubChem CID 118235409) has the molecular formula C23H46N2O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is (Z)-N-[(3R)-3-amino-4-hydroxy-2-methylbutyl]octadec-9-enamide.
| Compound Name | (Z)-N-[(3R)-3-amino-4-hydroxy-2-methylbutyl]octadec-9-enamide |
|---|---|
| PubChem CID | 118235409 |
| Molecular Formula | C23H46N2O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | (Z)-N-[(3R)-3-amino-4-hydroxy-2-methylbutyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCC(C)[C@@H](N)CO |
| InChI | InChI=1S/C23H46N2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)25-19-21(2)22(24)20-26/h10-11,21-22,26H,3-9,12-20,24H2,1-2H3,(H,25,27)/b11-10-/t21?,22-/m0/s1 |
| InChIKey | NRUFBQYRFGETFH-KWVLFGTJSA-N |
| XLogP | 5.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|