C23H46N2O2 — CID 53427633
N-[3-(dimethylamino)propyl]-12-hydroxyoctadec-9-enamide (PubChem CID 53427633) has the molecular formula C23H46N2O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-12-hydroxyoctadec-9-enamide.
| Compound Name | N-[3-(dimethylamino)propyl]-12-hydroxyoctadec-9-enamide |
|---|---|
| PubChem CID | 53427633 |
| Molecular Formula | C23H46N2O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-12-hydroxyoctadec-9-enamide |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(=O)NCCCN(C)C |
| InChI | InChI=1S/C23H46N2O2/c1-4-5-6-13-17-22(26)18-14-11-9-7-8-10-12-15-19-23(27)24-20-16-21-25(2)3/h11,14,22,26H,4-10,12-13,15-21H2,1-3H3,(H,24,27) |
| InChIKey | DWIUBTKCNCCGOO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|