C25H50N2O6S — CID 177185433
2-hydroxy-3-[2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 177185433) has the molecular formula C25H50N2O6S and a molecular weight of 506.75 g/mol. Its IUPAC name is 2-hydroxy-3-[2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 2-hydroxy-3-[2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177185433 |
| Molecular Formula | C25H50N2O6S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 2-hydroxy-3-[2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]ethyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NCC[N+](C)(C)CC(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C25H50N2O6S/c1-4-5-6-13-16-23(28)17-14-11-9-7-8-10-12-15-18-25(30)26-19-20-27(2,3)21-24(29)22-34(31,32)33/h11,14,23-24,28-29H,4-10,12-13,15-22H2,1-3H3,(H-,26,30,31,32,33)/b14-11-/t23-,24?/m1/s1 |
| InChIKey | COTOHKFXYWGHBJ-CIWZVUHSSA-N |
| XLogP | 3.09 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|