C36H72N3O7S+ — CID 162051324
2-hydroxy-3-[3-[[(E)-22-[2-hydroxybutyl(dimethyl)azaniumyl]-18-oxodocos-9-enoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 162051324) has the molecular formula C36H72N3O7S+ and a molecular weight of 691.05 g/mol. Its IUPAC name is 2-hydroxy-3-[3-[[(E)-22-[2-hydroxybutyl(dimethyl)azaniumyl]-18-oxodocos-9-enoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 2-hydroxy-3-[3-[[(E)-22-[2-hydroxybutyl(dimethyl)azaniumyl]-18-oxodocos-9-enoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 162051324 |
| Molecular Formula | C36H72N3O7S+ |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.51 |
| IUPAC Name | 2-hydroxy-3-[3-[[(E)-22-[2-hydroxybutyl(dimethyl)azaniumyl]-18-oxodocos-9-enoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CCC(O)C[N+](C)(C)CCCCC(=O)CCCCCCC/C=C/CCCCCCCC(=O)NCCC[N+](C)(C)CC(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C36H71N3O7S/c1-6-33(40)30-38(2,3)28-22-21-25-34(41)24-19-17-15-13-11-9-7-8-10-12-14-16-18-20-26-36(43)37-27-23-29-39(4,5)31-35(42)32-47(44,45)46/h7-8,33,35,40,42H,6,9-32H2,1-5H3/p+1/b8-7+ |
| InChIKey | YYOVTEIAVDADLA-BQYQJAHWSA-O |
| XLogP | 5.08 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|