C21H45N2O5S+ — CID 140615701
hydroxy-dimethyl-[3-(9-sulfohexadecanoylamino)propyl]azanium (PubChem CID 140615701) has the molecular formula C21H45N2O5S+ and a molecular weight of 437.67 g/mol. Its IUPAC name is hydroxy-dimethyl-[3-(9-sulfohexadecanoylamino)propyl]azanium.
| Compound Name | hydroxy-dimethyl-[3-(9-sulfohexadecanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 140615701 |
| Molecular Formula | C21H45N2O5S+ |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | hydroxy-dimethyl-[3-(9-sulfohexadecanoylamino)propyl]azanium |
| SMILES | CCCCCCCC(CCCCCCCC(=O)NCCC[N+](C)(C)O)S(=O)(=O)O |
| InChI | InChI=1S/C21H44N2O5S/c1-4-5-6-8-11-15-20(29(26,27)28)16-12-9-7-10-13-17-21(24)22-18-14-19-23(2,3)25/h20,25H,4-19H2,1-3H3,(H-,22,24,26,27,28)/p+1 |
| InChIKey | SBSDHGCKDIMDRM-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|