C17H37N2O4S+ — CID 140615714
hydroxy-dimethyl-[3-(9-sulfinododecanoylamino)propyl]azanium (PubChem CID 140615714) has the molecular formula C17H37N2O4S+ and a molecular weight of 365.56 g/mol. Its IUPAC name is hydroxy-dimethyl-[3-(9-sulfinododecanoylamino)propyl]azanium.
| Compound Name | hydroxy-dimethyl-[3-(9-sulfinododecanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 140615714 |
| Molecular Formula | C17H37N2O4S+ |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | hydroxy-dimethyl-[3-(9-sulfinododecanoylamino)propyl]azanium |
| SMILES | CCCC(CCCCCCCC(=O)NCCC[N+](C)(C)O)S(=O)O |
| InChI | InChI=1S/C17H36N2O4S/c1-4-11-16(24(22)23)12-8-6-5-7-9-13-17(20)18-14-10-15-19(2,3)21/h16,21H,4-15H2,1-3H3,(H-,18,20,22,23)/p+1 |
| InChIKey | CYDUPWYJYHHHRR-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|