C13H31N2O4S+ — CID 87688823
(2-hydroxy-3-sulfopropyl)-dimethyl-[3-(pentylamino)propyl]azanium (PubChem CID 87688823) has the molecular formula C13H31N2O4S+ and a molecular weight of 311.47 g/mol. Its IUPAC name is (2-hydroxy-3-sulfopropyl)-dimethyl-[3-(pentylamino)propyl]azanium.
| Compound Name | (2-hydroxy-3-sulfopropyl)-dimethyl-[3-(pentylamino)propyl]azanium |
|---|---|
| PubChem CID | 87688823 |
| Molecular Formula | C13H31N2O4S+ |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (2-hydroxy-3-sulfopropyl)-dimethyl-[3-(pentylamino)propyl]azanium |
| SMILES | CCCCCNCCC[N+](C)(C)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C13H30N2O4S/c1-4-5-6-8-14-9-7-10-15(2,3)11-13(16)12-20(17,18)19/h13-14,16H,4-12H2,1-3H3/p+1 |
| InChIKey | JGRJAISETZREPO-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|