C13H32N2O7S+2 — CID 173287964
carboxymethyl(trimethyl)azanium;3-hydroxypropyl-(2-hydroxy-3-sulfopropyl)-dimethylazanium (PubChem CID 173287964) has the molecular formula C13H32N2O7S+2 and a molecular weight of 360.47 g/mol. Its IUPAC name is carboxymethyl(trimethyl)azanium;3-hydroxypropyl-(2-hydroxy-3-sulfopropyl)-dimethylazanium.
| Compound Name | carboxymethyl(trimethyl)azanium;3-hydroxypropyl-(2-hydroxy-3-sulfopropyl)-dimethylazanium |
|---|---|
| PubChem CID | 173287964 |
| Molecular Formula | C13H32N2O7S+2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | carboxymethyl(trimethyl)azanium;3-hydroxypropyl-(2-hydroxy-3-sulfopropyl)-dimethylazanium |
| SMILES | C[N+](C)(C)CC(=O)O.C[N+](C)(CCCO)CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C8H19NO5S.C5H11NO2/c1-9(2,4-3-5-10)6-8(11)7-15(12,13)14;1-6(2,3)4-5(7)8/h8,10-11H,3-7H2,1-2H3;4H2,1-3H3/p+2 |
| InChIKey | QQTVADWPDVIKLH-UHFFFAOYSA-P |
| XLogP | -1.53 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|