About [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium
[(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium (PubChem CID 173359091) has the molecular formula C12H28N2O5+2
and a molecular weight of 280.37 g/mol. Its IUPAC name is [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium |
| PubChem CID | 173359091 |
| Molecular Formula | C12H28N2O5+2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CC(=O)O.C[N+](C)(C)CC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C7H15NO3.C5H11NO2/c1-8(2,3)5-4-6(9)7(10)11;1-6(2,3)4-5(7)8/h6,9H,4-5H2,1-3H3;4H2,1-3H3/p+2/t6-;/m1./s1 |
| InChIKey | CCSBUTGRZGGSPE-FYZOBXCZSA-P |
| XLogP | -0.69 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium?
The IUPAC name of [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium (CID 173359091) is [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium.
What is the SMILES notation for [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium?
The canonical SMILES for [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium is C[N+](C)(C)CC(=O)O.C[N+](C)(C)CC[C@@H](O)C(=O)O.
What is the InChIKey of [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium?
The InChIKey is CCSBUTGRZGGSPE-FYZOBXCZSA-P. The full InChI is InChI=1S/C7H15NO3.C5H11NO2/c1-8(2,3)5-4-6(9)7(10)11;1-6(2,3)4-5(7)8/h6,9H,4-5H2,1-3H3;4H2,1-3H3/p+2/t6-;/m1./s1.
What are the key properties of [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium?
[(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium has a molecular weight of 280.37 g/mol, XLogP of -0.69, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-carboxy-3-hydroxypropyl]-trimethylazanium;carboxymethyl(trimethyl)azanium is sourced from PubChem (CID 173359091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).