C8H16N2O3 — CID 173132431
acetic acid;N-(3-aminopropyl)prop-2-enamide (PubChem CID 173132431) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is acetic acid;N-(3-aminopropyl)prop-2-enamide.
| Compound Name | acetic acid;N-(3-aminopropyl)prop-2-enamide |
|---|---|
| PubChem CID | 173132431 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | acetic acid;N-(3-aminopropyl)prop-2-enamide |
| SMILES | C=CC(=O)NCCCN.CC(=O)O |
| InChI | InChI=1S/C6H12N2O.C2H4O2/c1-2-6(9)8-5-3-4-7;1-2(3)4/h2H,1,3-5,7H2,(H,8,9);1H3,(H,3,4) |
| InChIKey | CAJZTIKTEDXBRM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|