C15H27NO7 — CID 126628431
methyl 2-[[2-[2-[5-(2-oxopropoxy)pentoxy]ethoxy]acetyl]amino]acetate (PubChem CID 126628431) has the molecular formula C15H27NO7 and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl 2-[[2-[2-[5-(2-oxopropoxy)pentoxy]ethoxy]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[2-[5-(2-oxopropoxy)pentoxy]ethoxy]acetyl]amino]acetate |
|---|---|
| PubChem CID | 126628431 |
| Molecular Formula | C15H27NO7 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | methyl 2-[[2-[2-[5-(2-oxopropoxy)pentoxy]ethoxy]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)COCCOCCCCCOCC(C)=O |
| InChI | InChI=1S/C15H27NO7/c1-13(17)11-22-7-5-3-4-6-21-8-9-23-12-14(18)16-10-15(19)20-2/h3-12H2,1-2H3,(H,16,18) |
| InChIKey | VKPYNXSVSIPGQD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|