C8H16O5 — CID 54027919
2-[2-(3-methoxypropoxy)ethoxy]acetic acid (PubChem CID 54027919) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethoxy]acetic acid.
| Compound Name | 2-[2-(3-methoxypropoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 54027919 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethoxy]acetic acid |
| SMILES | COCCCOCCOCC(=O)O |
| InChI | InChI=1S/C8H16O5/c1-11-3-2-4-12-5-6-13-7-8(9)10/h2-7H2,1H3,(H,9,10) |
| InChIKey | LDNOLZKCEGCTMT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|