About 2-chloroacetate;(4-hydroxyphenyl)azanium
2-chloroacetate;(4-hydroxyphenyl)azanium (PubChem CID 139083952) has the molecular formula C8H10ClNO3
and a molecular weight of 203.62 g/mol. Its IUPAC name is 2-chloroacetate;(4-hydroxyphenyl)azanium.
Molecular Properties
| Compound Name | 2-chloroacetate;(4-hydroxyphenyl)azanium |
| PubChem CID | 139083952 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-chloroacetate;(4-hydroxyphenyl)azanium |
| SMILES | O=C([O-])CCl.[NH3+]c1ccc(O)cc1 |
| InChI | InChI=1S/C6H7NO.C2H3ClO2/c7-5-1-3-6(8)4-2-5;3-1-2(4)5/h1-4,8H,7H2;1H2,(H,4,5) |
| InChIKey | RWPUZLSRPXSYDD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetate;(4-hydroxyphenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetate;(4-hydroxyphenyl)azanium?
The IUPAC name of 2-chloroacetate;(4-hydroxyphenyl)azanium (CID 139083952) is 2-chloroacetate;(4-hydroxyphenyl)azanium.
What is the SMILES notation for 2-chloroacetate;(4-hydroxyphenyl)azanium?
The canonical SMILES for 2-chloroacetate;(4-hydroxyphenyl)azanium is O=C([O-])CCl.[NH3+]c1ccc(O)cc1.
What is the InChIKey of 2-chloroacetate;(4-hydroxyphenyl)azanium?
The InChIKey is RWPUZLSRPXSYDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C2H3ClO2/c7-5-1-3-6(8)4-2-5;3-1-2(4)5/h1-4,8H,7H2;1H2,(H,4,5).
What are the key properties of 2-chloroacetate;(4-hydroxyphenyl)azanium?
2-chloroacetate;(4-hydroxyphenyl)azanium has a molecular weight of 203.62 g/mol, XLogP of -0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetate;(4-hydroxyphenyl)azanium is sourced from PubChem (CID 139083952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).