About chloroethane;prop-2-enoate;trimethylazanium
chloroethane;prop-2-enoate;trimethylazanium (PubChem CID 146313295) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is chloroethane;prop-2-enoate;trimethylazanium.
Molecular Properties
| Compound Name | chloroethane;prop-2-enoate;trimethylazanium |
| PubChem CID | 146313295 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | chloroethane;prop-2-enoate;trimethylazanium |
| SMILES | C=CC(=O)[O-].CCCl.C[NH+](C)C |
| InChI | InChI=1S/C3H9N.C3H4O2.C2H5Cl/c1-4(2)3;1-2-3(4)5;1-2-3/h1-3H3;2H,1H2,(H,4,5);2H2,1H3 |
| InChIKey | BSJCLDZFOZQKIV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;prop-2-enoate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;prop-2-enoate;trimethylazanium?
The IUPAC name of chloroethane;prop-2-enoate;trimethylazanium (CID 146313295) is chloroethane;prop-2-enoate;trimethylazanium.
What is the SMILES notation for chloroethane;prop-2-enoate;trimethylazanium?
The canonical SMILES for chloroethane;prop-2-enoate;trimethylazanium is C=CC(=O)[O-].CCCl.C[NH+](C)C.
What is the InChIKey of chloroethane;prop-2-enoate;trimethylazanium?
The InChIKey is BSJCLDZFOZQKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C3H4O2.C2H5Cl/c1-4(2)3;1-2-3(4)5;1-2-3/h1-3H3;2H,1H2,(H,4,5);2H2,1H3.
What are the key properties of chloroethane;prop-2-enoate;trimethylazanium?
chloroethane;prop-2-enoate;trimethylazanium has a molecular weight of 195.69 g/mol, XLogP of -1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;prop-2-enoate;trimethylazanium is sourced from PubChem (CID 146313295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).