C9H11NO5 — CID 87091433
1-aminoethyl prop-2-enoate;furan-2,5-dione (PubChem CID 87091433) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 1-aminoethyl prop-2-enoate;furan-2,5-dione.
| Compound Name | 1-aminoethyl prop-2-enoate;furan-2,5-dione |
|---|---|
| PubChem CID | 87091433 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-aminoethyl prop-2-enoate;furan-2,5-dione |
| SMILES | C=CC(=O)OC(C)N.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H9NO2.C4H2O3/c1-3-5(7)8-4(2)6;5-3-1-2-4(6)7-3/h3-4H,1,6H2,2H3;1-2H |
| InChIKey | UMBYDDHYWHDMDP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|