C15H22O5 — CID 157127999
butyl prop-2-enoate;furan-2,5-dione;2-methylprop-1-ene (PubChem CID 157127999) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is butyl prop-2-enoate;furan-2,5-dione;2-methylprop-1-ene.
| Compound Name | butyl prop-2-enoate;furan-2,5-dione;2-methylprop-1-ene |
|---|---|
| PubChem CID | 157127999 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | butyl prop-2-enoate;furan-2,5-dione;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CC(=O)OCCCC.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C7H12O2.C4H2O3.C4H8/c1-3-5-6-9-7(8)4-2;5-3-1-2-4(6)7-3;1-4(2)3/h4H,2-3,5-6H2,1H3;1-2H;1H2,2-3H3 |
| InChIKey | AISPFZXEQIZUKN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|