About CID 172698071
CID 172698071 (PubChem CID 172698071) has the molecular formula C7H6NaO5
and a molecular weight of 193.11 g/mol.
Molecular Properties
| Compound Name | CID 172698071 |
| PubChem CID | 172698071 |
| Molecular Formula | C7H6NaO5 |
| Molecular Weight | 193.11 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | — |
| SMILES | C=CC(=O)O.O=C1C=CC(=O)O1.[Na] |
| InChI | InChI=1S/C4H2O3.C3H4O2.Na/c5-3-1-2-4(6)7-3;1-2-3(4)5;/h1-2H;2H,1H2,(H,4,5); |
| InChIKey | COZXHPAIYIALHT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.11 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 172698071 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172698071?
The IUPAC name of CID 172698071 (CID 172698071) is not available.
What is the SMILES notation for CID 172698071?
The canonical SMILES for CID 172698071 is C=CC(=O)O.O=C1C=CC(=O)O1.[Na].
What is the InChIKey of CID 172698071?
The InChIKey is COZXHPAIYIALHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C3H4O2.Na/c5-3-1-2-4(6)7-3;1-2-3(4)5;/h1-2H;2H,1H2,(H,4,5);.
What are the key properties of CID 172698071?
CID 172698071 has a molecular weight of 193.11 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172698071 is sourced from PubChem (CID 172698071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).