C15H18 — CID 144660679
1-ethyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]benzene (PubChem CID 144660679) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-ethyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]benzene.
| Compound Name | 1-ethyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]benzene |
|---|---|
| PubChem CID | 144660679 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-ethyl-4-[(2Z,4Z)-hepta-2,4,6-trienyl]benzene |
| SMILES | C=C/C=C\C=C/Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C15H18/c1-3-5-6-7-8-9-15-12-10-14(4-2)11-13-15/h3,5-8,10-13H,1,4,9H2,2H3/b6-5-,8-7- |
| InChIKey | NFPSWSUEQFCECG-ISTTXYCBSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|