C24H25N — CID 134257110
4-[(2Z,4Z)-hexa-2,4-dienyl]-N-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]aniline (PubChem CID 134257110) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is 4-[(2Z,4Z)-hexa-2,4-dienyl]-N-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]aniline.
| Compound Name | 4-[(2Z,4Z)-hexa-2,4-dienyl]-N-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]aniline |
|---|---|
| PubChem CID | 134257110 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 4-[(2Z,4Z)-hexa-2,4-dienyl]-N-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]aniline |
| SMILES | C=C/C=C\C=C\c1ccc(Nc2ccc(C/C=C\C=C/C)cc2)cc1 |
| InChI | InChI=1S/C24H25N/c1-3-5-7-9-11-21-13-17-23(18-14-21)25-24-19-15-22(16-20-24)12-10-8-6-4-2/h3-11,13-20,25H,1,12H2,2H3/b6-4-,7-5-,10-8-,11-9+ |
| InChIKey | RKSQGKZDHHGMSB-OVIRUMTGSA-N |
| XLogP | 6.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|