C12H20N2 — CID 90920104
1,1-diethyl-2-(4-ethylphenyl)hydrazine (PubChem CID 90920104) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1,1-diethyl-2-(4-ethylphenyl)hydrazine.
| Compound Name | 1,1-diethyl-2-(4-ethylphenyl)hydrazine |
|---|---|
| PubChem CID | 90920104 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1,1-diethyl-2-(4-ethylphenyl)hydrazine |
| SMILES | CCc1ccc(NN(CC)CC)cc1 |
| InChI | InChI=1S/C12H20N2/c1-4-11-7-9-12(10-8-11)13-14(5-2)6-3/h7-10,13H,4-6H2,1-3H3 |
| InChIKey | SUBMYYKNMRMODY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|